C12H17FN2O — CID 107796628
3-fluoro-4-[(oxolan-3-ylmethylamino)methyl]aniline (PubChem CID 107796628) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-fluoro-4-[(oxolan-3-ylmethylamino)methyl]aniline.
| Compound Name | 3-fluoro-4-[(oxolan-3-ylmethylamino)methyl]aniline |
|---|---|
| PubChem CID | 107796628 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-fluoro-4-[(oxolan-3-ylmethylamino)methyl]aniline |
| SMILES | Nc1ccc(CNCC2CCOC2)c(F)c1 |
| InChI | InChI=1S/C12H17FN2O/c13-12-5-11(14)2-1-10(12)7-15-6-9-3-4-16-8-9/h1-2,5,9,15H,3-4,6-8,14H2 |
| InChIKey | ATISXKOZLKXMIC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|