C16H12FNO3 — CID 107796635
2-fluoro-4-(1-oxo-3,4-dihydroisoquinolin-2-yl)benzoic acid (PubChem CID 107796635) has the molecular formula C16H12FNO3 and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-fluoro-4-(1-oxo-3,4-dihydroisoquinolin-2-yl)benzoic acid.
| Compound Name | 2-fluoro-4-(1-oxo-3,4-dihydroisoquinolin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 107796635 |
| Molecular Formula | C16H12FNO3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-fluoro-4-(1-oxo-3,4-dihydroisoquinolin-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCc3ccccc3C2=O)cc1F |
| InChI | InChI=1S/C16H12FNO3/c17-14-9-11(5-6-13(14)16(20)21)18-8-7-10-3-1-2-4-12(10)15(18)19/h1-6,9H,7-8H2,(H,20,21) |
| InChIKey | PICIIFZZPARGKC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |