C16H15BrN2O — CID 107797227
4-bromo-2-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]benzonitrile (PubChem CID 107797227) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-bromo-2-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]benzonitrile.
| Compound Name | 4-bromo-2-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 107797227 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-bromo-2-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]benzonitrile |
| SMILES | CC1CC1c1ccc(CNc2cc(Br)ccc2C#N)o1 |
| InChI | InChI=1S/C16H15BrN2O/c1-10-6-14(10)16-5-4-13(20-16)9-19-15-7-12(17)3-2-11(15)8-18/h2-5,7,10,14,19H,6,9H2,1H3 |
| InChIKey | NUYRQYXUCLMIJW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |