C15H17BrN4 — CID 107797835
4-bromo-2-[(1-butan-2-ylpyrazol-3-yl)methylamino]benzonitrile (PubChem CID 107797835) has the molecular formula C15H17BrN4 and a molecular weight of 333.23 g/mol. Its IUPAC name is 4-bromo-2-[(1-butan-2-ylpyrazol-3-yl)methylamino]benzonitrile.
| Compound Name | 4-bromo-2-[(1-butan-2-ylpyrazol-3-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 107797835 |
| Molecular Formula | C15H17BrN4 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-bromo-2-[(1-butan-2-ylpyrazol-3-yl)methylamino]benzonitrile |
| SMILES | CCC(C)n1ccc(CNc2cc(Br)ccc2C#N)n1 |
| InChI | InChI=1S/C15H17BrN4/c1-3-11(2)20-7-6-14(19-20)10-18-15-8-13(16)5-4-12(15)9-17/h4-8,11,18H,3,10H2,1-2H3 |
| InChIKey | TUIIQACKLBOIDN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |