C14H17N3O4 — CID 10779916
2-[(6-ethyl-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl-methylamino]acetic acid (PubChem CID 10779916) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[(6-ethyl-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl-methylamino]acetic acid.
| Compound Name | 2-[(6-ethyl-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 10779916 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[(6-ethyl-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl-methylamino]acetic acid |
| SMILES | CCc1ccc2[nH]c(=O)c(=O)[nH]c2c1CN(C)CC(=O)O |
| InChI | InChI=1S/C14H17N3O4/c1-3-8-4-5-10-12(16-14(21)13(20)15-10)9(8)6-17(2)7-11(18)19/h4-5H,3,6-7H2,1-2H3,(H,15,20)(H,16,21)(H,18,19) |
| InChIKey | DTYZQSMIWTZNMF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|