C17H25NO3 — CID 10779936
N-[(E,2S,3S)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]hexanamide (PubChem CID 10779936) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-[(E,2S,3S)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]hexanamide.
| Compound Name | N-[(E,2S,3S)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 10779936 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-[(E,2S,3S)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H](CO)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-2-3-5-10-17(21)18-15(13-19)16(20)12-11-14-8-6-4-7-9-14/h4,6-9,11-12,15-16,19-20H,2-3,5,10,13H2,1H3,(H,18,21)/b12-11+/t15-,16-/m0/s1 |
| InChIKey | VZCDEQFSSGANRG-WFPWZJHXSA-N |
| XLogP | 2.12 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|