About 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid
4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid (PubChem CID 10779992) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid |
| PubChem CID | 10779992 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid |
| SMILES | CC1(C)COC(c2ccc(C(=O)O)cc2)(C(C)(C)C)OC1 |
| InChI | InChI=1S/C17H24O4/c1-15(2,3)17(20-10-16(4,5)11-21-17)13-8-6-12(7-9-13)14(18)19/h6-9H,10-11H2,1-5H3,(H,18,19) |
| InChIKey | CHZXQSCNDMEQOY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid?
The IUPAC name of 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid (CID 10779992) is 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid.
What is the SMILES notation for 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid?
The canonical SMILES for 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid is CC1(C)COC(c2ccc(C(=O)O)cc2)(C(C)(C)C)OC1.
What is the InChIKey of 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid?
The InChIKey is CHZXQSCNDMEQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4/c1-15(2,3)17(20-10-16(4,5)11-21-17)13-8-6-12(7-9-13)14(18)19/h6-9H,10-11H2,1-5H3,(H,18,19).
What are the key properties of 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid?
4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid has a molecular weight of 292.38 g/mol, XLogP of 3.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)benzoic acid is sourced from PubChem (CID 10779992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).