C18H28O3 — CID 10780005
[(1S,3R,4aR,7S,8S,8aS)-8-formyl-3,7-dimethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 10780005) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is [(1S,3R,4aR,7S,8S,8aS)-8-formyl-3,7-dimethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1S,3R,4aR,7S,8S,8aS)-8-formyl-3,7-dimethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 10780005 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [(1S,3R,4aR,7S,8S,8aS)-8-formyl-3,7-dimethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@H](C)C[C@@H]2C=C[C@H](C)[C@H](C=O)[C@@H]12 |
| InChI | InChI=1S/C18H28O3/c1-5-12(3)18(20)21-16-9-11(2)8-14-7-6-13(4)15(10-19)17(14)16/h6-7,10-17H,5,8-9H2,1-4H3/t11-,12+,13+,14+,15+,16+,17+/m1/s1 |
| InChIKey | MZTOITDKJIMDOA-NBCJBSOISA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|