C14H11BrN4O — CID 107801255
N-(5-bromo-2-cyanophenyl)-6-(methylamino)pyridine-2-carboxamide (PubChem CID 107801255) has the molecular formula C14H11BrN4O and a molecular weight of 331.17 g/mol. Its IUPAC name is N-(5-bromo-2-cyanophenyl)-6-(methylamino)pyridine-2-carboxamide.
| Compound Name | N-(5-bromo-2-cyanophenyl)-6-(methylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107801255 |
| Molecular Formula | C14H11BrN4O |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-(5-bromo-2-cyanophenyl)-6-(methylamino)pyridine-2-carboxamide |
| SMILES | CNc1cccc(C(=O)Nc2cc(Br)ccc2C#N)n1 |
| InChI | InChI=1S/C14H11BrN4O/c1-17-13-4-2-3-11(18-13)14(20)19-12-7-10(15)6-5-9(12)8-16/h2-7H,1H3,(H,17,18)(H,19,20) |
| InChIKey | IJQOAJYWJGDGDB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |