C17H26O4 — CID 10780149
[(1R,2S,4aR,8aR)-4a-(hydroxymethyl)-8-methyl-6-oxo-2-propan-2-yl-1,2,3,4,5,8a-hexahydronaphthalen-1-yl] acetate (PubChem CID 10780149) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [(1R,2S,4aR,8aR)-4a-(hydroxymethyl)-8-methyl-6-oxo-2-propan-2-yl-1,2,3,4,5,8a-hexahydronaphthalen-1-yl] acetate.
| Compound Name | [(1R,2S,4aR,8aR)-4a-(hydroxymethyl)-8-methyl-6-oxo-2-propan-2-yl-1,2,3,4,5,8a-hexahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 10780149 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(1R,2S,4aR,8aR)-4a-(hydroxymethyl)-8-methyl-6-oxo-2-propan-2-yl-1,2,3,4,5,8a-hexahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C(C)C)CC[C@@]2(CO)CC(=O)C=C(C)[C@@H]12 |
| InChI | InChI=1S/C17H26O4/c1-10(2)14-5-6-17(9-18)8-13(20)7-11(3)15(17)16(14)21-12(4)19/h7,10,14-16,18H,5-6,8-9H2,1-4H3/t14-,15-,16+,17-/m0/s1 |
| InChIKey | OAASJLOTHOKQQN-NXOAAHMSSA-N |
| XLogP | 2.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |