About (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol
(6R)-2,6-dimethyloctadeca-2,17-dien-8-ol (PubChem CID 10780182) has the molecular formula C20H38O
and a molecular weight of 294.52 g/mol. Its IUPAC name is (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol.
Molecular Properties
| Compound Name | (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol |
| PubChem CID | 10780182 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol |
| SMILES | C=CCCCCCCCCC(O)C[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C20H38O/c1-5-6-7-8-9-10-11-12-16-20(21)17-19(4)15-13-14-18(2)3/h5,14,19-21H,1,6-13,15-17H2,2-4H3/t19-,20?/m1/s1 |
| InChIKey | FFXBEYHEWILWRK-FIWHBWSRSA-N |
| XLogP | 6.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol?
The IUPAC name of (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol (CID 10780182) is (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol.
What is the SMILES notation for (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol?
The canonical SMILES for (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol is C=CCCCCCCCCC(O)C[C@H](C)CCC=C(C)C.
What is the InChIKey of (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol?
The InChIKey is FFXBEYHEWILWRK-FIWHBWSRSA-N. The full InChI is InChI=1S/C20H38O/c1-5-6-7-8-9-10-11-12-16-20(21)17-19(4)15-13-14-18(2)3/h5,14,19-21H,1,6-13,15-17H2,2-4H3/t19-,20?/m1/s1.
What are the key properties of (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol?
(6R)-2,6-dimethyloctadeca-2,17-dien-8-ol has a molecular weight of 294.52 g/mol, XLogP of 6.43, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2,6-dimethyloctadeca-2,17-dien-8-ol is sourced from PubChem (CID 10780182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).