C12H10F5NO2 — CID 10780190
2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-3H-1,3-benzoxazin-4-one (PubChem CID 10780190) has the molecular formula C12H10F5NO2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-3H-1,3-benzoxazin-4-one.
| Compound Name | 2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-3H-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 10780190 |
| Molecular Formula | C12H10F5NO2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-3H-1,3-benzoxazin-4-one |
| SMILES | CC1(C)NC(=O)c2cc(C(F)(F)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C12H10F5NO2/c1-10(2)18-9(19)7-5-6(3-4-8(7)20-10)11(13,14)12(15,16)17/h3-5H,1-2H3,(H,18,19) |
| InChIKey | GKORVLQCQOZUDP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|