About 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile
2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile (PubChem CID 107802145) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile |
| PubChem CID | 107802145 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile |
| SMILES | Cc1cccc(N2CCCNC2=O)c1C#N |
| InChI | InChI=1S/C12H13N3O/c1-9-4-2-5-11(10(9)8-13)15-7-3-6-14-12(15)16/h2,4-5H,3,6-7H2,1H3,(H,14,16) |
| InChIKey | KBNPXHFFUNRBRN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile?
The IUPAC name of 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile (CID 107802145) is 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile.
What is the SMILES notation for 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile?
The canonical SMILES for 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile is Cc1cccc(N2CCCNC2=O)c1C#N.
What is the InChIKey of 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile?
The InChIKey is KBNPXHFFUNRBRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O/c1-9-4-2-5-11(10(9)8-13)15-7-3-6-14-12(15)16/h2,4-5H,3,6-7H2,1H3,(H,14,16).
What are the key properties of 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile?
2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile has a molecular weight of 215.26 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(2-oxo-1,3-diazinan-1-yl)benzonitrile is sourced from PubChem (CID 107802145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).