C9H13IO3 — CID 10780238
(5aS,9R,9aR)-9-iodo-5a,6,7,8,9,9a-hexahydro-5H-benzo[e][1,4]dioxepin-2-one (PubChem CID 10780238) has the molecular formula C9H13IO3 and a molecular weight of 296.10 g/mol. Its IUPAC name is (5aS,9R,9aR)-9-iodo-5a,6,7,8,9,9a-hexahydro-5H-benzo[e][1,4]dioxepin-2-one.
| Compound Name | (5aS,9R,9aR)-9-iodo-5a,6,7,8,9,9a-hexahydro-5H-benzo[e][1,4]dioxepin-2-one |
|---|---|
| PubChem CID | 10780238 |
| Molecular Formula | C9H13IO3 |
| Molecular Weight | 296.10 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | (5aS,9R,9aR)-9-iodo-5a,6,7,8,9,9a-hexahydro-5H-benzo[e][1,4]dioxepin-2-one |
| SMILES | O=C1COC[C@@H]2CCC[C@@H](I)[C@@H]2O1 |
| InChI | InChI=1S/C9H13IO3/c10-7-3-1-2-6-4-12-5-8(11)13-9(6)7/h6-7,9H,1-5H2/t6-,7+,9+/m0/s1 |
| InChIKey | VUGWDKARSBLOFT-LKEWCRSYSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.10 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|