C15H12FN3OS — CID 107802448
5-amino-N-(1,3-benzothiazol-6-yl)-2-fluoro-3-methylbenzamide (PubChem CID 107802448) has the molecular formula C15H12FN3OS and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-amino-N-(1,3-benzothiazol-6-yl)-2-fluoro-3-methylbenzamide.
| Compound Name | 5-amino-N-(1,3-benzothiazol-6-yl)-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 107802448 |
| Molecular Formula | C15H12FN3OS |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-amino-N-(1,3-benzothiazol-6-yl)-2-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(N)cc(C(=O)Nc2ccc3ncsc3c2)c1F |
| InChI | InChI=1S/C15H12FN3OS/c1-8-4-9(17)5-11(14(8)16)15(20)19-10-2-3-12-13(6-10)21-7-18-12/h2-7H,17H2,1H3,(H,19,20) |
| InChIKey | YWSPUCPDNQDNOW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|