About 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile
2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile (PubChem CID 107803393) has the molecular formula C11H12F2N2
and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile.
Molecular Properties
| Compound Name | 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile |
| PubChem CID | 107803393 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile |
| SMILES | Cc1cccc(NC(C)C(F)F)c1C#N |
| InChI | InChI=1S/C11H12F2N2/c1-7-4-3-5-10(9(7)6-14)15-8(2)11(12)13/h3-5,8,11,15H,1-2H3 |
| InChIKey | FYSRFZRPXZOYLI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile?
The IUPAC name of 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile (CID 107803393) is 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile.
What is the SMILES notation for 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile?
The canonical SMILES for 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile is Cc1cccc(NC(C)C(F)F)c1C#N.
What is the InChIKey of 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile?
The InChIKey is FYSRFZRPXZOYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2/c1-7-4-3-5-10(9(7)6-14)15-8(2)11(12)13/h3-5,8,11,15H,1-2H3.
What are the key properties of 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile?
2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile has a molecular weight of 210.23 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoropropan-2-ylamino)-6-methylbenzonitrile is sourced from PubChem (CID 107803393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).