C17H15FN2S — CID 107803874
N-[cyclopropyl-(4-fluorophenyl)methyl]-1,3-benzothiazol-6-amine (PubChem CID 107803874) has the molecular formula C17H15FN2S and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[cyclopropyl-(4-fluorophenyl)methyl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[cyclopropyl-(4-fluorophenyl)methyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107803874 |
| Molecular Formula | C17H15FN2S |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-[cyclopropyl-(4-fluorophenyl)methyl]-1,3-benzothiazol-6-amine |
| SMILES | Fc1ccc(C(Nc2ccc3ncsc3c2)C2CC2)cc1 |
| InChI | InChI=1S/C17H15FN2S/c18-13-5-3-12(4-6-13)17(11-1-2-11)20-14-7-8-15-16(9-14)21-10-19-15/h3-11,17,20H,1-2H2 |
| InChIKey | VZSDPTSMMDTBRM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |