methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate

C18H18O4 — CID 10780402

IUPACmethyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate
SMILESCOC(=O)c1c2c(c3ccccc3c1OC)OC(C)(C)C=C2
InChIInChI=1S/C18H18O4/c1-18(2)10-9-13-14(17(19)21-4)16(20-3)12-8-6-5-7-11(12)15(13)22-18/h5-10H,1-4H3
InChIKeyPNVZCKPOXBYJKA-UHFFFAOYSA-N
MW298.34 g/mol
LogP3.82
Rot. Bonds2

About methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate

methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate (PubChem CID 10780402) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate.

Molecular Properties

Compound Namemethyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate
PubChem CID10780402
Molecular FormulaC18H18O4
Molecular Weight298.34 g/mol
Exact Mass298.12
IUPAC Namemethyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate
SMILESCOC(=O)c1c2c(c3ccccc3c1OC)OC(C)(C)C=C2
InChIInChI=1S/C18H18O4/c1-18(2)10-9-13-14(17(19)21-4)16(20-3)12-8-6-5-7-11(12)15(13)22-18/h5-10H,1-4H3
InChIKeyPNVZCKPOXBYJKA-UHFFFAOYSA-N
XLogP3.82
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.34
LogP ≤ 53.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate?
The IUPAC name of methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate (CID 10780402) is methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate.
What is the SMILES notation for methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate?
The canonical SMILES for methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate is COC(=O)c1c2c(c3ccccc3c1OC)OC(C)(C)C=C2.
What is the InChIKey of methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate?
The InChIKey is PNVZCKPOXBYJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4/c1-18(2)10-9-13-14(17(19)21-4)16(20-3)12-8-6-5-7-11(12)15(13)22-18/h5-10H,1-4H3.
What are the key properties of methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate?
methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate has a molecular weight of 298.34 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate is sourced from PubChem (CID 10780402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).