C14H12N2O3S — CID 107805884
5-[1-(1,3-benzothiazol-6-ylamino)ethyl]furan-2-carboxylic acid (PubChem CID 107805884) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 5-[1-(1,3-benzothiazol-6-ylamino)ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-(1,3-benzothiazol-6-ylamino)ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 107805884 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-[1-(1,3-benzothiazol-6-ylamino)ethyl]furan-2-carboxylic acid |
| SMILES | CC(Nc1ccc2ncsc2c1)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C14H12N2O3S/c1-8(11-4-5-12(19-11)14(17)18)16-9-2-3-10-13(6-9)20-7-15-10/h2-8,16H,1H3,(H,17,18) |
| InChIKey | SCZDALRZEKDUHW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |