C13H13Cl2NO3 — CID 10780669
1-(2,2-dichloroacetyl)-11-methoxy-2-azaspiro[5.5]undeca-1,7,10-trien-9-one (PubChem CID 10780669) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is 1-(2,2-dichloroacetyl)-11-methoxy-2-azaspiro[5.5]undeca-1,7,10-trien-9-one.
| Compound Name | 1-(2,2-dichloroacetyl)-11-methoxy-2-azaspiro[5.5]undeca-1,7,10-trien-9-one |
|---|---|
| PubChem CID | 10780669 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1-(2,2-dichloroacetyl)-11-methoxy-2-azaspiro[5.5]undeca-1,7,10-trien-9-one |
| SMILES | COC1=CC(=O)C=CC12CCCN=C2C(=O)C(Cl)Cl |
| InChI | InChI=1S/C13H13Cl2NO3/c1-19-9-7-8(17)3-5-13(9)4-2-6-16-11(13)10(18)12(14)15/h3,5,7,12H,2,4,6H2,1H3 |
| InChIKey | PVHCULDXRWALFW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|