C13H13N3O2S — CID 107806702
1-(1,3-benzothiazol-6-yl)-3-ethylpiperazine-2,5-dione (PubChem CID 107806702) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-6-yl)-3-ethylpiperazine-2,5-dione.
| Compound Name | 1-(1,3-benzothiazol-6-yl)-3-ethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107806702 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(1,3-benzothiazol-6-yl)-3-ethylpiperazine-2,5-dione |
| SMILES | CCC1NC(=O)CN(c2ccc3ncsc3c2)C1=O |
| InChI | InChI=1S/C13H13N3O2S/c1-2-9-13(18)16(6-12(17)15-9)8-3-4-10-11(5-8)19-7-14-10/h3-5,7,9H,2,6H2,1H3,(H,15,17) |
| InChIKey | ZKTNGSPEGJDOPA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |