C12H16O9 — CID 10780798
1-O-ethyl 7-O-methyl (1R,3R,4R,5R,7S)-3,4-dihydroxy-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate (PubChem CID 10780798) has the molecular formula C12H16O9 and a molecular weight of 304.25 g/mol. Its IUPAC name is 1-O-ethyl 7-O-methyl (1R,3R,4R,5R,7S)-3,4-dihydroxy-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate.
| Compound Name | 1-O-ethyl 7-O-methyl (1R,3R,4R,5R,7S)-3,4-dihydroxy-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 10780798 |
| Molecular Formula | C12H16O9 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-O-ethyl 7-O-methyl (1R,3R,4R,5R,7S)-3,4-dihydroxy-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@@](C)(O[C@@H]1C(=O)OC)[C@H](O)[C@@H](O)C2=O |
| InChI | InChI=1S/C12H16O9/c1-4-19-10(17)12-7(15)5(13)6(14)11(2,21-12)20-8(12)9(16)18-3/h5-6,8,13-14H,4H2,1-3H3/t5-,6-,8-,11-,12+/m1/s1 |
| InChIKey | UEGNIVHESDKXAX-HHIYWQQFSA-N |
| XLogP | -2.10 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|