About 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile
3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile (PubChem CID 107808225) has the molecular formula C9H7ClF3N3O2S
and a molecular weight of 313.69 g/mol. Its IUPAC name is 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile |
| PubChem CID | 107808225 |
| Molecular Formula | C9H7ClF3N3O2S |
| Molecular Weight | 313.69 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile |
| SMILES | N#Cc1ccc(NS(=O)(=O)NCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H7ClF3N3O2S/c10-7-3-6(4-14)1-2-8(7)16-19(17,18)15-5-9(11,12)13/h1-3,15-16H,5H2 |
| InChIKey | LQVSNDXSESUNFJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile?
The IUPAC name of 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile (CID 107808225) is 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile.
What is the SMILES notation for 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile?
The canonical SMILES for 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile is N#Cc1ccc(NS(=O)(=O)NCC(F)(F)F)c(Cl)c1.
What is the InChIKey of 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile?
The InChIKey is LQVSNDXSESUNFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF3N3O2S/c10-7-3-6(4-14)1-2-8(7)16-19(17,18)15-5-9(11,12)13/h1-3,15-16H,5H2.
What are the key properties of 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile?
3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile has a molecular weight of 313.69 g/mol, XLogP of 2.02, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(2,2,2-trifluoroethylsulfamoylamino)benzonitrile is sourced from PubChem (CID 107808225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).