C18H32O2Si — CID 10781147
2-[(1R,2S,5S)-2-ethenyl-2-methyl-5-propan-2-yl-5-trimethylsilyloxycyclohexyl]prop-2-enal (PubChem CID 10781147) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is 2-[(1R,2S,5S)-2-ethenyl-2-methyl-5-propan-2-yl-5-trimethylsilyloxycyclohexyl]prop-2-enal.
| Compound Name | 2-[(1R,2S,5S)-2-ethenyl-2-methyl-5-propan-2-yl-5-trimethylsilyloxycyclohexyl]prop-2-enal |
|---|---|
| PubChem CID | 10781147 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-[(1R,2S,5S)-2-ethenyl-2-methyl-5-propan-2-yl-5-trimethylsilyloxycyclohexyl]prop-2-enal |
| SMILES | C=C[C@]1(C)CC[C@@](O[Si](C)(C)C)(C(C)C)C[C@H]1C(=C)C=O |
| InChI | InChI=1S/C18H32O2Si/c1-9-17(5)10-11-18(14(2)3,20-21(6,7)8)12-16(17)15(4)13-19/h9,13-14,16H,1,4,10-12H2,2-3,5-8H3/t16-,17+,18-/m0/s1 |
| InChIKey | QSQBQHQBGQYSTF-KSZLIROESA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|