C16H17FN4 — CID 107811482
5-(5-fluoro-1-propylbenzimidazol-2-yl)benzene-1,3-diamine (PubChem CID 107811482) has the molecular formula C16H17FN4 and a molecular weight of 284.34 g/mol. Its IUPAC name is 5-(5-fluoro-1-propylbenzimidazol-2-yl)benzene-1,3-diamine.
| Compound Name | 5-(5-fluoro-1-propylbenzimidazol-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811482 |
| Molecular Formula | C16H17FN4 |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 5-(5-fluoro-1-propylbenzimidazol-2-yl)benzene-1,3-diamine |
| SMILES | CCCn1c(-c2cc(N)cc(N)c2)nc2cc(F)ccc21 |
| InChI | InChI=1S/C16H17FN4/c1-2-5-21-15-4-3-11(17)8-14(15)20-16(21)10-6-12(18)9-13(19)7-10/h3-4,6-9H,2,5,18-19H2,1H3 |
| InChIKey | ZLNHGVFJSBODAK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|