About 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate
3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate (PubChem CID 1078123) has the molecular formula C19H18N2O5
and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate |
| PubChem CID | 1078123 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate |
| SMILES | CCOC(=O)c1cnc2c(C(=O)OC)cccc2c1NCc1ccco1 |
| InChI | InChI=1S/C19H18N2O5/c1-3-25-19(23)15-11-21-16-13(7-4-8-14(16)18(22)24-2)17(15)20-10-12-6-5-9-26-12/h4-9,11H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | CMPMWFWTBFJNCV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate?
The IUPAC name of 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate (CID 1078123) is 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate?
The canonical SMILES for 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate is CCOC(=O)c1cnc2c(C(=O)OC)cccc2c1NCc1ccco1.
What is the InChIKey of 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate?
The InChIKey is CMPMWFWTBFJNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5/c1-3-25-19(23)15-11-21-16-13(7-4-8-14(16)18(22)24-2)17(15)20-10-12-6-5-9-26-12/h4-9,11H,3,10H2,1-2H3,(H,20,21).
What are the key properties of 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate?
3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate has a molecular weight of 354.36 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 8-O-methyl 4-(furan-2-ylmethylamino)quinoline-3,8-dicarboxylate is sourced from PubChem (CID 1078123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).