C18H18N2O3 — CID 10781258
3-[(E)-3-anilino-3-oxoprop-1-enyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid (PubChem CID 10781258) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 10781258 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid |
| SMILES | O=C(/C=C/c1c(C(=O)O)[nH]c2c1CCCC2)Nc1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c21-16(19-12-6-2-1-3-7-12)11-10-14-13-8-4-5-9-15(13)20-17(14)18(22)23/h1-3,6-7,10-11,20H,4-5,8-9H2,(H,19,21)(H,22,23)/b11-10+ |
| InChIKey | URRGAFSCBNTAKM-ZHACJKMWSA-N |
| XLogP | 3.24 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|