About N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide
N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide (PubChem CID 10781321) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide.
Molecular Properties
| Compound Name | N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide |
| PubChem CID | 10781321 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1[C@H]1CC(=O)[C@H](CO)O1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO4/c20-11-17-15(21)10-16(23-17)13-8-4-5-9-14(13)19-18(22)12-6-2-1-3-7-12/h1-9,16-17,20H,10-11H2,(H,19,22)/t16-,17+/m1/s1 |
| InChIKey | ICRXUVRCAXPHLX-SJORKVTESA-N |
| XLogP | 2.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide?
The IUPAC name of N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide (CID 10781321) is N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide.
What is the SMILES notation for N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide?
The canonical SMILES for N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide is O=C(Nc1ccccc1[C@H]1CC(=O)[C@H](CO)O1)c1ccccc1.
What is the InChIKey of N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide?
The InChIKey is ICRXUVRCAXPHLX-SJORKVTESA-N. The full InChI is InChI=1S/C18H17NO4/c20-11-17-15(21)10-16(23-17)13-8-4-5-9-14(13)19-18(22)12-6-2-1-3-7-12/h1-9,16-17,20H,10-11H2,(H,19,22)/t16-,17+/m1/s1.
What are the key properties of N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide?
N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide has a molecular weight of 311.34 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2R,5S)-5-(hydroxymethyl)-4-oxooxolan-2-yl]phenyl]benzamide is sourced from PubChem (CID 10781321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).