C17H17N3O3 — CID 10781328
N'-hydroxy-2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-6-carboximidamide (PubChem CID 10781328) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-6-carboximidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-6-carboximidamide |
|---|---|
| PubChem CID | 10781328 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-6-carboximidamide |
| SMILES | CC1(C)C=C(n2ccccc2=O)c2cc(/C(N)=N\O)ccc2O1 |
| InChI | InChI=1S/C17H17N3O3/c1-17(2)10-13(20-8-4-3-5-15(20)21)12-9-11(16(18)19-22)6-7-14(12)23-17/h3-10,22H,1-2H3,(H2,18,19) |
| InChIKey | KEZBCWIGKPWZFZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|