C11H12BrNO4S — CID 107813615
4-bromo-3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid (PubChem CID 107813615) has the molecular formula C11H12BrNO4S and a molecular weight of 334.19 g/mol. Its IUPAC name is 4-bromo-3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid.
| Compound Name | 4-bromo-3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 107813615 |
| Molecular Formula | C11H12BrNO4S |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 4-bromo-3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid |
| SMILES | CC1CN(c2cc(C(=O)O)ccc2Br)S(=O)(=O)C1 |
| InChI | InChI=1S/C11H12BrNO4S/c1-7-5-13(18(16,17)6-7)10-4-8(11(14)15)2-3-9(10)12/h2-4,7H,5-6H2,1H3,(H,14,15) |
| InChIKey | UHHMXEWMNLRLKB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |