C11H10BrN3O3 — CID 107813813
ethyl 5-(3-amino-4-bromophenyl)-1,2,4-oxadiazole-3-carboxylate (PubChem CID 107813813) has the molecular formula C11H10BrN3O3 and a molecular weight of 312.12 g/mol. Its IUPAC name is ethyl 5-(3-amino-4-bromophenyl)-1,2,4-oxadiazole-3-carboxylate.
| Compound Name | ethyl 5-(3-amino-4-bromophenyl)-1,2,4-oxadiazole-3-carboxylate |
|---|---|
| PubChem CID | 107813813 |
| Molecular Formula | C11H10BrN3O3 |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | ethyl 5-(3-amino-4-bromophenyl)-1,2,4-oxadiazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(-c2ccc(Br)c(N)c2)n1 |
| InChI | InChI=1S/C11H10BrN3O3/c1-2-17-11(16)9-14-10(18-15-9)6-3-4-7(12)8(13)5-6/h3-5H,2,13H2,1H3 |
| InChIKey | POPWDVQRJISWFC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|