C14H19BrN2O3 — CID 107814148
4-bromo-3-(4-methylpentylcarbamoylamino)benzoic acid (PubChem CID 107814148) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 4-bromo-3-(4-methylpentylcarbamoylamino)benzoic acid.
| Compound Name | 4-bromo-3-(4-methylpentylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107814148 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-bromo-3-(4-methylpentylcarbamoylamino)benzoic acid |
| SMILES | CC(C)CCCNC(=O)Nc1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C14H19BrN2O3/c1-9(2)4-3-7-16-14(20)17-12-8-10(13(18)19)5-6-11(12)15/h5-6,8-9H,3-4,7H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | ZCNGEGUUCGPIBK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|