C12H27NO2 — CID 107815051
(2S)-3-(7-methyloctylamino)propane-1,2-diol (PubChem CID 107815051) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is (2S)-3-(7-methyloctylamino)propane-1,2-diol.
| Compound Name | (2S)-3-(7-methyloctylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 107815051 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | (2S)-3-(7-methyloctylamino)propane-1,2-diol |
| SMILES | CC(C)CCCCCCNC[C@H](O)CO |
| InChI | InChI=1S/C12H27NO2/c1-11(2)7-5-3-4-6-8-13-9-12(15)10-14/h11-15H,3-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | INWJICXYMLOMLM-LBPRGKRZSA-N |
| XLogP | 1.54 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|