C14H23N3O2 — CID 107815534
5-(7-methyloctylamino)pyrazine-2-carboxylic acid (PubChem CID 107815534) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-(7-methyloctylamino)pyrazine-2-carboxylic acid.
| Compound Name | 5-(7-methyloctylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107815534 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 5-(7-methyloctylamino)pyrazine-2-carboxylic acid |
| SMILES | CC(C)CCCCCCNc1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C14H23N3O2/c1-11(2)7-5-3-4-6-8-15-13-10-16-12(9-17-13)14(18)19/h9-11H,3-8H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | IAQIQADSRNUEPT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|