About 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole
2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole (PubChem CID 107817185) has the molecular formula C16H21ClF2N2
and a molecular weight of 314.81 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole |
| PubChem CID | 107817185 |
| Molecular Formula | C16H21ClF2N2 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole |
| SMILES | CCCCC(CC)Cn1c(CCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C16H21ClF2N2/c1-3-5-6-11(4-2)10-21-14(9-17)20-13-8-7-12(18)15(19)16(13)21/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | MKCQCPJYYGNCCF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole?
The IUPAC name of 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole (CID 107817185) is 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole.
What is the SMILES notation for 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole?
The canonical SMILES for 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole is CCCCC(CC)Cn1c(CCl)nc2ccc(F)c(F)c21.
What is the InChIKey of 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole?
The InChIKey is MKCQCPJYYGNCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClF2N2/c1-3-5-6-11(4-2)10-21-14(9-17)20-13-8-7-12(18)15(19)16(13)21/h7-8,11H,3-6,9-10H2,1-2H3.
What are the key properties of 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole?
2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole has a molecular weight of 314.81 g/mol, XLogP of 5.27, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1-(2-ethylhexyl)-6,7-difluorobenzimidazole is sourced from PubChem (CID 107817185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).