About (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate
(4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate (PubChem CID 10781739) has the molecular formula C18H23NO4
and a molecular weight of 317.38 g/mol. Its IUPAC name is (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate.
Molecular Properties
| Compound Name | (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate |
| PubChem CID | 10781739 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate |
| SMILES | CCCCCCC/C=C/C=C/C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H23NO4/c1-2-3-4-5-6-7-8-9-10-11-18(20)23-17-14-12-16(13-15-17)19(21)22/h8-15H,2-7H2,1H3/b9-8+,11-10+ |
| InChIKey | DHNCWGHWKIUHQS-BNFZFUHLSA-N |
| XLogP | 4.97 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate?
The IUPAC name of (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate (CID 10781739) is (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate.
What is the SMILES notation for (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate?
The canonical SMILES for (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate is CCCCCCC/C=C/C=C/C(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate?
The InChIKey is DHNCWGHWKIUHQS-BNFZFUHLSA-N. The full InChI is InChI=1S/C18H23NO4/c1-2-3-4-5-6-7-8-9-10-11-18(20)23-17-14-12-16(13-15-17)19(21)22/h8-15H,2-7H2,1H3/b9-8+,11-10+.
What are the key properties of (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate?
(4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate has a molecular weight of 317.38 g/mol, XLogP of 4.97, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) (2E,4E)-dodeca-2,4-dienoate is sourced from PubChem (CID 10781739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).