C18H23NO4 — CID 10781742
benzyl N-[(1S)-3-methyl-1-[(2R)-4-methylidene-5-oxooxolan-2-yl]butyl]carbamate (PubChem CID 10781742) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is benzyl N-[(1S)-3-methyl-1-[(2R)-4-methylidene-5-oxooxolan-2-yl]butyl]carbamate.
| Compound Name | benzyl N-[(1S)-3-methyl-1-[(2R)-4-methylidene-5-oxooxolan-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 10781742 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | benzyl N-[(1S)-3-methyl-1-[(2R)-4-methylidene-5-oxooxolan-2-yl]butyl]carbamate |
| SMILES | C=C1C[C@H]([C@H](CC(C)C)NC(=O)OCc2ccccc2)OC1=O |
| InChI | InChI=1S/C18H23NO4/c1-12(2)9-15(16-10-13(3)17(20)23-16)19-18(21)22-11-14-7-5-4-6-8-14/h4-8,12,15-16H,3,9-11H2,1-2H3,(H,19,21)/t15-,16+/m0/s1 |
| InChIKey | AVFMQDOBTLUQEI-JKSUJKDBSA-N |
| XLogP | 3.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|