C19H27NO3 — CID 10781755
methyl (2R)-2-[[(3R)-3,7-dimethyloct-6-enoyl]amino]-2-phenylacetate (PubChem CID 10781755) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is methyl (2R)-2-[[(3R)-3,7-dimethyloct-6-enoyl]amino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[[(3R)-3,7-dimethyloct-6-enoyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 10781755 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | methyl (2R)-2-[[(3R)-3,7-dimethyloct-6-enoyl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](NC(=O)C[C@H](C)CCC=C(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-14(2)9-8-10-15(3)13-17(21)20-18(19(22)23-4)16-11-6-5-7-12-16/h5-7,9,11-12,15,18H,8,10,13H2,1-4H3,(H,20,21)/t15-,18-/m1/s1 |
| InChIKey | FYEREEUDYBVCHF-CRAIPNDOSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|