C20H19N3O4S — CID 1078176
2-ethoxy-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 1078176) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-ethoxy-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-ethoxy-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1078176 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-ethoxy-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C20H19N3O4S/c1-2-27-18-8-4-3-7-17(18)20(24)22-15-10-12-16(13-11-15)28(25,26)23-19-9-5-6-14-21-19/h3-14H,2H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | LBTAJBKPBRUCEL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |