C17H29NO — CID 107817925
1-(2-ethylhexyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 107817925) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(2-ethylhexyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 107817925 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-(2-ethylhexyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | CCCCC(CC)Cn1c(C)cc2c1CCCC2O |
| InChI | InChI=1S/C17H29NO/c1-4-6-8-14(5-2)12-18-13(3)11-15-16(18)9-7-10-17(15)19/h11,14,17,19H,4-10,12H2,1-3H3 |
| InChIKey | HBRNSWJOICHIBR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |