C23H26O — CID 10781844
(1S,3R)-4,4-dimethyl-1-phenyl-1,3-bis(prop-2-enyl)-3H-isochromene (PubChem CID 10781844) has the molecular formula C23H26O and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,3R)-4,4-dimethyl-1-phenyl-1,3-bis(prop-2-enyl)-3H-isochromene.
| Compound Name | (1S,3R)-4,4-dimethyl-1-phenyl-1,3-bis(prop-2-enyl)-3H-isochromene |
|---|---|
| PubChem CID | 10781844 |
| Molecular Formula | C23H26O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (1S,3R)-4,4-dimethyl-1-phenyl-1,3-bis(prop-2-enyl)-3H-isochromene |
| SMILES | C=CC[C@H]1O[C@@](CC=C)(c2ccccc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C23H26O/c1-5-12-21-22(3,4)19-15-10-11-16-20(19)23(24-21,17-6-2)18-13-8-7-9-14-18/h5-11,13-16,21H,1-2,12,17H2,3-4H3/t21-,23+/m1/s1 |
| InChIKey | AIDJIFNOIARGSU-GGAORHGYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|