C16H30N4 — CID 107818951
6-N,2,5-trimethyl-4-N-(7-methyloctyl)pyrimidine-4,6-diamine (PubChem CID 107818951) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 6-N,2,5-trimethyl-4-N-(7-methyloctyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N,2,5-trimethyl-4-N-(7-methyloctyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107818951 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 6-N,2,5-trimethyl-4-N-(7-methyloctyl)pyrimidine-4,6-diamine |
| SMILES | CNc1nc(C)nc(NCCCCCCC(C)C)c1C |
| InChI | InChI=1S/C16H30N4/c1-12(2)10-8-6-7-9-11-18-16-13(3)15(17-5)19-14(4)20-16/h12H,6-11H2,1-5H3,(H2,17,18,19,20) |
| InChIKey | HCJGWYAFYOPHDR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|