About 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione
6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione (PubChem CID 10781935) has the molecular formula C13H6BrNO2S
and a molecular weight of 320.17 g/mol. Its IUPAC name is 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione.
Molecular Properties
| Compound Name | 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione |
| PubChem CID | 10781935 |
| Molecular Formula | C13H6BrNO2S |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione |
| SMILES | O=C1C=C(Br)C(=O)c2sc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C13H6BrNO2S/c14-8-6-9(16)10-12(11(8)17)18-13(15-10)7-4-2-1-3-5-7/h1-6H |
| InChIKey | OYAQCYXPULHTFU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione?
The IUPAC name of 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione (CID 10781935) is 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione.
What is the SMILES notation for 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione?
The canonical SMILES for 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione is O=C1C=C(Br)C(=O)c2sc(-c3ccccc3)nc21.
What is the InChIKey of 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione?
The InChIKey is OYAQCYXPULHTFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6BrNO2S/c14-8-6-9(16)10-12(11(8)17)18-13(15-10)7-4-2-1-3-5-7/h1-6H.
What are the key properties of 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione?
6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione has a molecular weight of 320.17 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-phenyl-1,3-benzothiazole-4,7-dione is sourced from PubChem (CID 10781935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).