About (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid
(3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid (PubChem CID 10782010) has the molecular formula C17H17F2NO3
and a molecular weight of 321.32 g/mol. Its IUPAC name is (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid |
| PubChem CID | 10782010 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(F)(F)[C@@H](N[C@@H](CO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17F2NO3/c18-17(19,16(22)23)15(13-9-5-2-6-10-13)20-14(11-21)12-7-3-1-4-8-12/h1-10,14-15,20-21H,11H2,(H,22,23)/t14-,15-/m0/s1 |
| InChIKey | AJSWJHQBOPNUTI-GJZGRUSLSA-N |
| XLogP | 2.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid?
The IUPAC name of (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid (CID 10782010) is (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid.
What is the SMILES notation for (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid?
The canonical SMILES for (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid is O=C(O)C(F)(F)[C@@H](N[C@@H](CO)c1ccccc1)c1ccccc1.
What is the InChIKey of (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid?
The InChIKey is AJSWJHQBOPNUTI-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H17F2NO3/c18-17(19,16(22)23)15(13-9-5-2-6-10-13)20-14(11-21)12-7-3-1-4-8-12/h1-10,14-15,20-21H,11H2,(H,22,23)/t14-,15-/m0/s1.
What are the key properties of (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid?
(3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid has a molecular weight of 321.32 g/mol, XLogP of 2.77, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,2-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-phenylpropanoic acid is sourced from PubChem (CID 10782010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).