C12H14BrNO5S — CID 107820452
(2S)-2-[(5-bromo-4-methylthiophene-2-carbonyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107820452) has the molecular formula C12H14BrNO5S and a molecular weight of 364.22 g/mol. Its IUPAC name is (2S)-2-[(5-bromo-4-methylthiophene-2-carbonyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[(5-bromo-4-methylthiophene-2-carbonyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820452 |
| Molecular Formula | C12H14BrNO5S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | (2S)-2-[(5-bromo-4-methylthiophene-2-carbonyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)c1cc(C)c(Br)s1)C(=O)O |
| InChI | InChI=1S/C12H14BrNO5S/c1-6-5-8(20-10(6)13)11(16)14-7(12(17)18)3-4-9(15)19-2/h5,7H,3-4H2,1-2H3,(H,14,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | BXPUJOXVSJSKCL-ZETCQYMHSA-N |
| XLogP | 1.96 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |