C17H22O6 — CID 10782075
methyl (3R,4S,5S)-5-methoxy-4-[methoxy-(4-methylphenyl)methyl]-5-methyl-2-oxooxolane-3-carboxylate (PubChem CID 10782075) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl (3R,4S,5S)-5-methoxy-4-[methoxy-(4-methylphenyl)methyl]-5-methyl-2-oxooxolane-3-carboxylate.
| Compound Name | methyl (3R,4S,5S)-5-methoxy-4-[methoxy-(4-methylphenyl)methyl]-5-methyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 10782075 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | methyl (3R,4S,5S)-5-methoxy-4-[methoxy-(4-methylphenyl)methyl]-5-methyl-2-oxooxolane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)O[C@](C)(OC)[C@@H]1C(OC)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22O6/c1-10-6-8-11(9-7-10)14(20-3)13-12(15(18)21-4)16(19)23-17(13,2)22-5/h6-9,12-14H,1-5H3/t12-,13+,14?,17+/m1/s1 |
| InChIKey | OYGIRKAMKPAZSP-HMCVZBPISA-N |
| XLogP | 2.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|