C13H13NO4S — CID 107821667
(2S)-2-(1-benzothiophene-2-carbonylamino)-4-hydroxybutanoic acid (PubChem CID 107821667) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is (2S)-2-(1-benzothiophene-2-carbonylamino)-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-(1-benzothiophene-2-carbonylamino)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107821667 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | (2S)-2-(1-benzothiophene-2-carbonylamino)-4-hydroxybutanoic acid |
| SMILES | O=C(N[C@@H](CCO)C(=O)O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H13NO4S/c15-6-5-9(13(17)18)14-12(16)11-7-8-3-1-2-4-10(8)19-11/h1-4,7,9,15H,5-6H2,(H,14,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | ULKMJLCDKIEPIP-VIFPVBQESA-N |
| XLogP | 1.47 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |