About [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate
[(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate (PubChem CID 10782412) has the molecular formula C12H26O4S2Si
and a molecular weight of 326.56 g/mol. Its IUPAC name is [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate.
Molecular Properties
| Compound Name | [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate |
| PubChem CID | 10782412 |
| Molecular Formula | C12H26O4S2Si |
| Molecular Weight | 326.56 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C[C@H](OS(C)(=O)=O)CS1 |
| InChI | InChI=1S/C12H26O4S2Si/c1-12(2,3)19(5,6)15-8-11-7-10(9-17-11)16-18(4,13)14/h10-11H,7-9H2,1-6H3/t10-,11+/m0/s1 |
| InChIKey | DTTMYJMJHVPWBE-WDEREUQCSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate?
The IUPAC name of [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate (CID 10782412) is [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate.
What is the SMILES notation for [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate?
The canonical SMILES for [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate is CC(C)(C)[Si](C)(C)OC[C@H]1C[C@H](OS(C)(=O)=O)CS1.
What is the InChIKey of [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate?
The InChIKey is DTTMYJMJHVPWBE-WDEREUQCSA-N. The full InChI is InChI=1S/C12H26O4S2Si/c1-12(2,3)19(5,6)15-8-11-7-10(9-17-11)16-18(4,13)14/h10-11H,7-9H2,1-6H3/t10-,11+/m0/s1.
What are the key properties of [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate?
[(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate has a molecular weight of 326.56 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-3-yl] methanesulfonate is sourced from PubChem (CID 10782412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).