C14H21N3O4 — CID 107824874
(2S)-4-hydroxy-2-[(1-piperidin-4-ylpyrrole-2-carbonyl)amino]butanoic acid (PubChem CID 107824874) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[(1-piperidin-4-ylpyrrole-2-carbonyl)amino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[(1-piperidin-4-ylpyrrole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107824874 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (2S)-4-hydroxy-2-[(1-piperidin-4-ylpyrrole-2-carbonyl)amino]butanoic acid |
| SMILES | O=C(N[C@@H](CCO)C(=O)O)c1cccn1C1CCNCC1 |
| InChI | InChI=1S/C14H21N3O4/c18-9-5-11(14(20)21)16-13(19)12-2-1-8-17(12)10-3-6-15-7-4-10/h1-2,8,10-11,15,18H,3-7,9H2,(H,16,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | AAZKLSVIXGDWGB-NSHDSACASA-N |
| XLogP | -0.02 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |