C14H20N2O5S — CID 10782504
1-benzyl-3-[(1R,2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-2-(hydroxymethyl)cyclopentyl]thiourea (PubChem CID 10782504) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-benzyl-3-[(1R,2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-2-(hydroxymethyl)cyclopentyl]thiourea.
| Compound Name | 1-benzyl-3-[(1R,2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-2-(hydroxymethyl)cyclopentyl]thiourea |
|---|---|
| PubChem CID | 10782504 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-benzyl-3-[(1R,2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-2-(hydroxymethyl)cyclopentyl]thiourea |
| SMILES | OC[C@]1(O)[C@H](NC(=S)NCc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20N2O5S/c17-7-14(21)11(9(18)10(19)12(14)20)16-13(22)15-6-8-4-2-1-3-5-8/h1-5,9-12,17-21H,6-7H2,(H2,15,16,22)/t9-,10-,11-,12+,14+/m1/s1 |
| InChIKey | SMSONUFGJMXKKR-SSKLVLDBSA-N |
| XLogP | -2.16 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|